C14H14Cl2O2 — CID 98551304
(1S,3S,4S,5R,7S,8R)-1,5-dichloro-4,8-bis[(E)-prop-1-enyl]tricyclo[5.1.0.03,5]octane-2,6-dione (PubChem CID 98551304) has the molecular formula C14H14Cl2O2 and a molecular weight of 285.17 g/mol. Its IUPAC name is (1S,3S,4S,5R,7S,8R)-1,5-dichloro-4,8-bis[(E)-prop-1-enyl]tricyclo[5.1.0.03,5]octane-2,6-dione.
| Compound Name | (1S,3S,4S,5R,7S,8R)-1,5-dichloro-4,8-bis[(E)-prop-1-enyl]tricyclo[5.1.0.03,5]octane-2,6-dione |
|---|---|
| PubChem CID | 98551304 |
| Molecular Formula | C14H14Cl2O2 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (1S,3S,4S,5R,7S,8R)-1,5-dichloro-4,8-bis[(E)-prop-1-enyl]tricyclo[5.1.0.03,5]octane-2,6-dione |
| SMILES | C/C=C/[C@@H]1[C@H]2C(=O)[C@]3(Cl)[C@H](C(=O)[C@]12Cl)[C@@H]3/C=C/C |
| InChI | InChI=1S/C14H14Cl2O2/c1-3-5-7-9-11(17)14(16)8(6-4-2)10(14)12(18)13(7,9)15/h3-10H,1-2H3/b5-3+,6-4+/t7-,8+,9-,10-,13+,14-/m0/s1 |
| InChIKey | YOKDVLMTTYBDEZ-BFEDXZKVSA-N |
| XLogP | 2.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|