C9H3Cl5O3 — CID 20624592
1,7,8,9,10-pentachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 20624592) has the molecular formula C9H3Cl5O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1,7,8,9,10-pentachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1,7,8,9,10-pentachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 20624592 |
| Molecular Formula | C9H3Cl5O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 333.85 |
| IUPAC Name | 1,7,8,9,10-pentachloro-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1OC(=O)C2C1C1(Cl)C(Cl)=C(Cl)C2(Cl)C1Cl |
| InChI | InChI=1S/C9H3Cl5O3/c10-3-4(11)9(14)2-1(5(15)17-6(2)16)8(3,13)7(9)12/h1-2,7H |
| InChIKey | SPNJRJLWYJXHLM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|