C12H4Cl4O6 — CID 98523330
(2R,6R,8S,12R)-1,7,13,14-tetrachloro-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 98523330) has the molecular formula C12H4Cl4O6 and a molecular weight of 385.97 g/mol. Its IUPAC name is (2R,6R,8S,12R)-1,7,13,14-tetrachloro-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (2R,6R,8S,12R)-1,7,13,14-tetrachloro-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 98523330 |
| Molecular Formula | C12H4Cl4O6 |
| Molecular Weight | 385.97 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | (2R,6R,8S,12R)-1,7,13,14-tetrachloro-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1C1(Cl)C(Cl)=C(Cl)C2(Cl)[C@H]2C(=O)OC(=O)[C@@H]21 |
| InChI | InChI=1S/C12H4Cl4O6/c13-5-6(14)12(16)2-1(7(17)21-8(2)18)11(5,15)3-4(12)10(20)22-9(3)19/h1-4H/t1-,2-,3-,4+,11?,12?/m1/s1 |
| InChIKey | LDFYOAUEDOLDGH-BGTUOXRKSA-N |
| XLogP | 1.29 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.97 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|