C12H8O6 — CID 149335878
6,12-dioxapentacyclo[7.5.0.01,3.04,8.010,14]tetradecane-5,7,11,13-tetrone (PubChem CID 149335878) has the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. Its IUPAC name is 6,12-dioxapentacyclo[7.5.0.01,3.04,8.010,14]tetradecane-5,7,11,13-tetrone.
| Compound Name | 6,12-dioxapentacyclo[7.5.0.01,3.04,8.010,14]tetradecane-5,7,11,13-tetrone |
|---|---|
| PubChem CID | 149335878 |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 6,12-dioxapentacyclo[7.5.0.01,3.04,8.010,14]tetradecane-5,7,11,13-tetrone |
| SMILES | O=C1OC(=O)C2C1C1CC13C1C(=O)OC(=O)C1C23 |
| InChI | InChI=1S/C12H8O6/c13-8-3-2-1-12(2)6(4(3)9(14)17-8)5-7(12)11(16)18-10(5)15/h2-7H,1H2 |
| InChIKey | YDFNCSCJSNPXJC-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|