C18H24N6O6 — CID 163951311
8,8,9-triamino-9-(8,9,9-triamino-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 163951311) has the molecular formula C18H24N6O6 and a molecular weight of 420.43 g/mol. Its IUPAC name is 8,8,9-triamino-9-(8,9,9-triamino-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 8,8,9-triamino-9-(8,9,9-triamino-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 163951311 |
| Molecular Formula | C18H24N6O6 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 8,8,9-triamino-9-(8,9,9-triamino-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]decan-8-yl)-4-oxatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | NC1(N)C2CC(C3C(=O)OC(=O)C32)C1(N)C1(N)C2CC(C3C(=O)OC(=O)C32)C1(N)N |
| InChI | InChI=1S/C18H24N6O6/c19-15(3-1-5(17(15,21)22)9-7(3)11(25)29-13(9)27)16(20)4-2-6(18(16,23)24)10-8(4)12(26)30-14(10)28/h3-10H,1-2,19-24H2 |
| InChIKey | RZNWZMKBXQLXTN-UHFFFAOYSA-N |
| XLogP | -4.46 |
| TPSA | 242.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|