C21H20O7 — CID 122607722
CID 122607722 (PubChem CID 122607722) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol.
| Compound Name | CID 122607722 |
|---|---|
| PubChem CID | 122607722 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | — |
| SMILES | O=C1OC(=O)[C@@H]2C1[C@H]1C[C@H]2C[C@]12CC[C@@]1(C[C@@H]3C[C@H]1C1C(=O)OC(=O)[C@H]13)C2=O |
| InChI | InChI=1S/C21H20O7/c22-15-11-7-3-9(13(11)17(24)27-15)20(5-7)1-2-21(19(20)26)6-8-4-10(21)14-12(8)16(23)28-18(14)25/h7-14H,1-6H2/t7-,8-,9-,10+,11-,12-,13?,14?,20-,21+/m0/s1 |
| InChIKey | OVASAEXSPYGGES-CXTRJAGMSA-N |
| XLogP | 1.03 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|