C9H8O4 — CID 98116525
(1R,2R,6R,7S)-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione (PubChem CID 98116525) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is (1R,2R,6R,7S)-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione.
| Compound Name | (1R,2R,6R,7S)-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione |
|---|---|
| PubChem CID | 98116525 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | (1R,2R,6R,7S)-4-oxatricyclo[5.2.1.02,6]decane-3,5,8-trione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]1[C@H]1CC(=O)[C@H]2C1 |
| InChI | InChI=1S/C9H8O4/c10-5-2-3-1-4(5)7-6(3)8(11)13-9(7)12/h3-4,6-7H,1-2H2/t3-,4-,6-,7-/m1/s1 |
| InChIKey | ZCXGUBDTAVCGOT-PFFCINGUSA-N |
| XLogP | -0.09 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|