C16H26O5Si2 — CID 12528306
(1S,2S,6R,7R)-8,9-bis(trimethylsilyloxy)-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 12528306) has the molecular formula C16H26O5Si2 and a molecular weight of 354.55 g/mol. Its IUPAC name is (1S,2S,6R,7R)-8,9-bis(trimethylsilyloxy)-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7R)-8,9-bis(trimethylsilyloxy)-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 12528306 |
| Molecular Formula | C16H26O5Si2 |
| Molecular Weight | 354.55 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (1S,2S,6R,7R)-8,9-bis(trimethylsilyloxy)-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H]2CC[C@H]1[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C16H26O5Si2/c1-22(2,3)20-13-9-7-8-10(14(13)21-23(4,5)6)12-11(9)15(17)19-16(12)18/h9-12H,7-8H2,1-6H3/t9-,10+,11-,12+ |
| InChIKey | AJOWRZKRUKWTHK-BKUVIOGVSA-N |
| XLogP | 3.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|