C15H16O3 — CID 117070396
12-oxapentacyclo[7.5.1.13,7.02,8.010,14]hexadec-2(8)-ene-11,13-dione (PubChem CID 117070396) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 12-oxapentacyclo[7.5.1.13,7.02,8.010,14]hexadec-2(8)-ene-11,13-dione.
| Compound Name | 12-oxapentacyclo[7.5.1.13,7.02,8.010,14]hexadec-2(8)-ene-11,13-dione |
|---|---|
| PubChem CID | 117070396 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 12-oxapentacyclo[7.5.1.13,7.02,8.010,14]hexadec-2(8)-ene-11,13-dione |
| SMILES | O=C1OC(=O)C2C3CC(C4=C3C3CCCC4C3)C12 |
| InChI | InChI=1S/C15H16O3/c16-14-12-8-5-9(13(12)15(17)18-14)11-7-3-1-2-6(4-7)10(8)11/h6-9,12-13H,1-5H2 |
| InChIKey | BFPGCZVTXJKJCL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|