C11H12O4 — CID 98163373
(1R,2S,6R,7S)-4-oxatricyclo[5.3.2.02,6]dodecane-3,5,8-trione (PubChem CID 98163373) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-oxatricyclo[5.3.2.02,6]dodecane-3,5,8-trione.
| Compound Name | (1R,2S,6R,7S)-4-oxatricyclo[5.3.2.02,6]dodecane-3,5,8-trione |
|---|---|
| PubChem CID | 98163373 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (1R,2S,6R,7S)-4-oxatricyclo[5.3.2.02,6]dodecane-3,5,8-trione |
| SMILES | O=C1OC(=O)[C@H]2[C@@H]1[C@H]1CCC(=O)[C@H]2CC1 |
| InChI | InChI=1S/C11H12O4/c12-7-4-2-5-1-3-6(7)9-8(5)10(13)15-11(9)14/h5-6,8-9H,1-4H2/t5-,6-,8+,9-/m1/s1 |
| InChIKey | XJBOJUWKNBPRLZ-MTSNSDSCSA-N |
| XLogP | 0.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|