C13H14O6 — CID 144809445
methyl 3,5-dioxo-8-(2-oxoethyl)-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 144809445) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is methyl 3,5-dioxo-8-(2-oxoethyl)-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | methyl 3,5-dioxo-8-(2-oxoethyl)-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 144809445 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl 3,5-dioxo-8-(2-oxoethyl)-4-oxatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | COC(=O)C1(CC=O)CC2CC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C13H14O6/c1-18-12(17)13(2-3-14)5-6-4-7(13)9-8(6)10(15)19-11(9)16/h3,6-9H,2,4-5H2,1H3 |
| InChIKey | WKIWJXQYYYEGRN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|