C21H28O2 — CID 146653346
methyl (8S)-4-ethylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate (PubChem CID 146653346) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is methyl (8S)-4-ethylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate.
| Compound Name | methyl (8S)-4-ethylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate |
|---|---|
| PubChem CID | 146653346 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | methyl (8S)-4-ethylhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate |
| SMILES | CCC1(C(=O)OC)CC2CC1C1C3C[C@H](C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C21H28O2/c1-3-21(20(22)23-2)9-12-7-15(21)19-14-8-13(18(12)19)16-10-4-5-11(6-10)17(14)16/h4-5,10-19H,3,6-9H2,1-2H3/t10?,11?,12?,13-,14?,15?,16?,17?,18?,19?,21?/m1/s1 |
| InChIKey | FHXDVHKLCNGWNM-MHXUPPCVSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|