C23H32O3 — CID 139797200
tert-butyl (4-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) carbonate (PubChem CID 139797200) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl (4-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) carbonate.
| Compound Name | tert-butyl (4-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) carbonate |
|---|---|
| PubChem CID | 139797200 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | tert-butyl (4-methyl-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl) carbonate |
| SMILES | CC(C)(C)OC(=O)OC1(C)CC2CC1C1C3CC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C23H32O3/c1-22(2,3)25-21(24)26-23(4)10-13-8-16(23)20-15-9-14(19(13)20)17-11-5-6-12(7-11)18(15)17/h5-6,11-20H,7-10H2,1-4H3 |
| InChIKey | RQLCPVCQBIVSQH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|