C20H30O2 — CID 139807429
tert-butyl 3-(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate (PubChem CID 139807429) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is tert-butyl 3-(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate.
| Compound Name | tert-butyl 3-(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate |
|---|---|
| PubChem CID | 139807429 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | tert-butyl 3-(4-methyl-4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)propanoate |
| SMILES | CC(C)(C)OC(=O)CCC1(C)CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C20H30O2/c1-19(2,3)22-16(21)7-8-20(4)11-14-10-15(20)18-13-6-5-12(9-13)17(14)18/h5-6,12-15,17-18H,7-11H2,1-4H3 |
| InChIKey | SDNCWDUTXZBXFN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|