C24H31ClO2Si — CID 140513953
(tert-butyl-chloro-phenylsilyl) 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 140513953) has the molecular formula C24H31ClO2Si and a molecular weight of 415.05 g/mol. Its IUPAC name is (tert-butyl-chloro-phenylsilyl) 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (tert-butyl-chloro-phenylsilyl) 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 140513953 |
| Molecular Formula | C24H31ClO2Si |
| Molecular Weight | 415.05 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (tert-butyl-chloro-phenylsilyl) 4-methyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC1(C(=O)O[Si](Cl)(c2ccccc2)C(C)(C)C)CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C24H31ClO2Si/c1-23(2,3)28(25,18-8-6-5-7-9-18)27-22(26)24(4)14-17-13-19(24)21-16-11-10-15(12-16)20(17)21/h5-11,15-17,19-21H,12-14H2,1-4H3 |
| InChIKey | AWMKVDKKEHGXPU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.05 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|