C16H20O4 — CID 141049820
4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid (PubChem CID 141049820) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid.
| Compound Name | 4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 141049820 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C2CC(C3C4C=CC(C4)C32)C1(C)C(=O)O |
| InChI | InChI=1S/C16H20O4/c1-15(13(17)18)9-6-10(16(15,2)14(19)20)12-8-4-3-7(5-8)11(9)12/h3-4,7-12H,5-6H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | UYRPCQKBHWGNSH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|