C37H42 — CID 162121013
9-methyl-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene;9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 162121013) has the molecular formula C37H42 and a molecular weight of 486.74 g/mol. Its IUPAC name is 9-methyl-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene;9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9-methyl-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene;9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 162121013 |
| Molecular Formula | C37H42 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 9-methyl-9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene;9-phenyltetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | C1=CC2CC1C1C3CC(c4ccccc4)C(C3)C21.CC1(c2ccccc2)CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C19H22.C18H20/c1-19(15-5-3-2-4-6-15)11-14-10-16(19)18-13-8-7-12(9-13)17(14)18;1-2-4-11(5-3-1)15-9-14-10-16(15)18-13-7-6-12(8-13)17(14)18/h2-8,12-14,16-18H,9-11H2,1H3;1-7,12-18H,8-10H2 |
| InChIKey | ZHKFAXOWNOMDGE-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|