C21H26 — CID 139698198
9-(2,4,6-trimethylphenyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 139698198) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is 9-(2,4,6-trimethylphenyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9-(2,4,6-trimethylphenyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 139698198 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 9-(2,4,6-trimethylphenyl)tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | Cc1cc(C)c(C2CC3CC2C2C4C=CC(C4)C32)c(C)c1 |
| InChI | InChI=1S/C21H26/c1-11-6-12(2)19(13(3)7-11)17-9-16-10-18(17)21-15-5-4-14(8-15)20(16)21/h4-7,14-18,20-21H,8-10H2,1-3H3 |
| InChIKey | CMDZFFWAWRAPKT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|