C23H30O — CID 177445375
(1R,8R,9R)-9-[4-(butan-2-yloxymethyl)phenyl]tetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 177445375) has the molecular formula C23H30O and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,8R,9R)-9-[4-(butan-2-yloxymethyl)phenyl]tetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1R,8R,9R)-9-[4-(butan-2-yloxymethyl)phenyl]tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 177445375 |
| Molecular Formula | C23H30O |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (1R,8R,9R)-9-[4-(butan-2-yloxymethyl)phenyl]tetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | CCC(C)OCc1ccc([C@@H]2CC3C[C@@H]2C2C4C=CC(C4)C32)cc1 |
| InChI | InChI=1S/C23H30O/c1-3-14(2)24-13-15-4-6-16(7-5-15)20-11-19-12-21(20)23-18-9-8-17(10-18)22(19)23/h4-9,14,17-23H,3,10-13H2,1-2H3/t14?,17?,18?,19?,20-,21-,22?,23?/m0/s1 |
| InChIKey | JCWLWSIHOIPVMH-NEGGLNETSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|