C20H26O2Si — CID 90893345
dimethoxy-phenyl-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane (PubChem CID 90893345) has the molecular formula C20H26O2Si and a molecular weight of 326.51 g/mol. Its IUPAC name is dimethoxy-phenyl-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane.
| Compound Name | dimethoxy-phenyl-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane |
|---|---|
| PubChem CID | 90893345 |
| Molecular Formula | C20H26O2Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | dimethoxy-phenyl-(4-tetracyclo[6.2.1.13,6.02,7]dodec-9-enyl)silane |
| SMILES | CO[Si](OC)(c1ccccc1)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C20H26O2Si/c1-21-23(22-2,16-6-4-3-5-7-16)18-12-15-11-17(18)20-14-9-8-13(10-14)19(15)20/h3-9,13-15,17-20H,10-12H2,1-2H3 |
| InChIKey | GBVOUAWDOJCQTG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|