C12H16S — CID 88871327
tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol (PubChem CID 88871327) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol.
| Compound Name | tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol |
|---|---|
| PubChem CID | 88871327 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol |
| SMILES | SC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C12H16S/c13-10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h1-2,6-13H,3-5H2 |
| InChIKey | UWLJDZFODXSWFH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|