About tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol
tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol (PubChem CID 88871327) has the molecular formula C12H16S
and a molecular weight of 192.33 g/mol. Its IUPAC name is tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol.
Molecular Properties
| Compound Name | tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol |
| PubChem CID | 88871327 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol |
| SMILES | SC1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C12H16S/c13-10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h1-2,6-13H,3-5H2 |
| InChIKey | UWLJDZFODXSWFH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol?
The IUPAC name of tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol (CID 88871327) is tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol.
What is the SMILES notation for tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol?
The canonical SMILES for tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol is SC1CC2CC1C1C3C=CC(C3)C21.
What is the InChIKey of tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol?
The InChIKey is UWLJDZFODXSWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16S/c13-10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h1-2,6-13H,3-5H2.
What are the key properties of tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol?
tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol has a molecular weight of 192.33 g/mol, XLogP of 2.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-thiol is sourced from PubChem (CID 88871327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).