C17H24O — CID 172688740
9-cyclopentyloxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 172688740) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 9-cyclopentyloxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | 9-cyclopentyloxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 172688740 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 9-cyclopentyloxytetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | C1=CC2CC1C1C3CC(OC4CCCC4)C(C3)C21 |
| InChI | InChI=1S/C17H24O/c1-2-4-13(3-1)18-15-9-12-8-14(15)17-11-6-5-10(7-11)16(12)17/h5-6,10-17H,1-4,7-9H2 |
| InChIKey | BJQYWOSLCHJRPU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|