C20H30O2 — CID 157102741
cyclopentyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;ethane (PubChem CID 157102741) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is cyclopentyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;ethane.
| Compound Name | cyclopentyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;ethane |
|---|---|
| PubChem CID | 157102741 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | cyclopentyl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;ethane |
| SMILES | CC.O=C(OC1CCCC1)C1CC2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C18H24O2.C2H6/c19-18(20-13-3-1-2-4-13)15-9-12-8-14(15)17-11-6-5-10(7-11)16(12)17;1-2/h5-6,10-17H,1-4,7-9H2;1-2H3 |
| InChIKey | AFYIOLAWLXYKCZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|