C20H26O2 — CID 22967748
(1-methylcyclohex-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 22967748) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (1-methylcyclohex-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (1-methylcyclohex-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 22967748 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1-methylcyclohex-2-en-1-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC1(OC(=O)C2CC3CC2C2C4C=CC(C4)C32)C=CCCC1 |
| InChI | InChI=1S/C20H26O2/c1-20(7-3-2-4-8-20)22-19(21)16-11-14-10-15(16)18-13-6-5-12(9-13)17(14)18/h3,5-7,12-18H,2,4,8-11H2,1H3 |
| InChIKey | ZFGSUOAXPSKTGX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|