C19H24O3 — CID 158936368
(1-methylcyclopent-2-en-1-yl) 10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboxylate (PubChem CID 158936368) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (1-methylcyclopent-2-en-1-yl) 10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboxylate.
| Compound Name | (1-methylcyclopent-2-en-1-yl) 10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboxylate |
|---|---|
| PubChem CID | 158936368 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (1-methylcyclopent-2-en-1-yl) 10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboxylate |
| SMILES | CC1(OC(=O)C2CC3CC2C2C4CC(C5OC45)C32)C=CCC1 |
| InChI | InChI=1S/C19H24O3/c1-19(4-2-3-5-19)22-18(20)11-7-9-6-10(11)15-13-8-12(14(9)15)16-17(13)21-16/h2,4,9-17H,3,5-8H2,1H3 |
| InChIKey | HLAQAIYTRAORJL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|