C14H15F3NO4S- — CID 164777427
(4Z)-N-(trifluoromethylsulfonyl)-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboximidate (PubChem CID 164777427) has the molecular formula C14H15F3NO4S- and a molecular weight of 350.34 g/mol. Its IUPAC name is (4Z)-N-(trifluoromethylsulfonyl)-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboximidate.
| Compound Name | (4Z)-N-(trifluoromethylsulfonyl)-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboximidate |
|---|---|
| PubChem CID | 164777427 |
| Molecular Formula | C14H15F3NO4S- |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (4Z)-N-(trifluoromethylsulfonyl)-10-oxapentacyclo[6.3.1.13,6.02,7.09,11]tridecane-4-carboximidate |
| SMILES | O=S(=O)(/N=C(\[O-])C1CC2CC1C1C3CC(C4OC34)C21)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO4S/c15-14(16,17)23(20,21)18-13(19)6-2-4-1-5(6)10-8-3-7(9(4)10)11-12(8)22-11/h4-12H,1-3H2,(H,18,19)/p-1 |
| InChIKey | UIZCDKMPIWCPBL-UHFFFAOYSA-M |
| XLogP | 0.90 |
| TPSA | 82.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|