C9H7F3NO6S- — CID 155621477
(9Z)-5-oxo-N-(trifluoromethylsulfonyl)-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboximidate (PubChem CID 155621477) has the molecular formula C9H7F3NO6S- and a molecular weight of 314.22 g/mol. Its IUPAC name is (9Z)-5-oxo-N-(trifluoromethylsulfonyl)-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboximidate.
| Compound Name | (9Z)-5-oxo-N-(trifluoromethylsulfonyl)-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboximidate |
|---|---|
| PubChem CID | 155621477 |
| Molecular Formula | C9H7F3NO6S- |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | (9Z)-5-oxo-N-(trifluoromethylsulfonyl)-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboximidate |
| SMILES | O=C1OC2CC3OC2C1C3/C([O-])=N/S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO6S/c10-9(11,12)20(16,17)13-7(14)4-2-1-3-6(18-2)5(4)8(15)19-3/h2-6H,1H2,(H,13,14)/p-1 |
| InChIKey | DHEYBFZXACMYQY-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 105.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|