About (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane
(3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane (PubChem CID 98544246) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane.
Analyze (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane?
The IUPAC name of (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane (CID 98544246) is (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane.
What is the SMILES notation for (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane?
The canonical SMILES for (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane is C1C2C[C@H]3[C@@H]1[C@H]1O[C@H]3C21.
What is the InChIKey of (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane?
The InChIKey is YGBMQJMVFJIMQT-BTUUJGARSA-N. The full InChI is InChI=1S/C8H10O/c1-3-2-5-4(1)7-6(3)8(5)9-7/h3-8H,1-2H2/t3?,4-,5+,6?,7-,8-/m1/s1.
What are the key properties of (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane?
(3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane has a molecular weight of 122.17 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5R,6R,7S)-4-oxatetracyclo[4.2.1.02,5.03,7]nonane is sourced from PubChem (CID 98544246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).