C7H10O — CID 98043746
(1R,2R,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 98043746) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is (1R,2R,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane.
| Compound Name | (1R,2R,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 98043746 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (1R,2R,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | C1C[C@@H]2C[C@@H]1[C@H]1O[C@H]21 |
| InChI | InChI=1S/C7H10O/c1-2-5-3-4(1)6-7(5)8-6/h4-7H,1-3H2/t4-,5-,6-,7-/m1/s1 |
| InChIKey | OHNNZOOGWXZCPZ-DBRKOABJSA-N |
| XLogP | 1.18 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|