C13H22O3 — CID 90693172
methyl 2-methylbutanoate;3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 90693172) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is methyl 2-methylbutanoate;3-oxatricyclo[3.2.1.02,4]octane.
| Compound Name | methyl 2-methylbutanoate;3-oxatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 90693172 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | methyl 2-methylbutanoate;3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | C1CC2CC1C1OC21.CCC(C)C(=O)OC |
| InChI | InChI=1S/C7H10O.C6H12O2/c1-2-5-3-4(1)6-7(5)8-6;1-4-5(2)6(7)8-3/h4-7H,1-3H2;5H,4H2,1-3H3 |
| InChIKey | ZRTGSQSUIQZSGA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|