About (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile
(2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile (PubChem CID 138551448) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile.
Molecular Properties
| Compound Name | (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile |
| PubChem CID | 138551448 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile |
| SMILES | N#CC1CC2CC(C1)[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C9H11NO/c10-4-5-1-6-3-7(2-5)9-8(6)11-9/h5-9H,1-3H2/t5?,6?,7?,8-,9+ |
| InChIKey | FABKICLPUHZIIK-RFKBBFAZSA-N |
| XLogP | 1.32 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
The IUPAC name of (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile (CID 138551448) is (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile.
What is the SMILES notation for (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
The canonical SMILES for (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile is N#CC1CC2CC(C1)[C@@H]1O[C@H]21.
What is the InChIKey of (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
The InChIKey is FABKICLPUHZIIK-RFKBBFAZSA-N. The full InChI is InChI=1S/C9H11NO/c10-4-5-1-6-3-7(2-5)9-8(6)11-9/h5-9H,1-3H2/t5?,6?,7?,8-,9+.
What are the key properties of (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
(2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile has a molecular weight of 149.19 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-3-oxatricyclo[3.3.1.02,4]nonane-7-carbonitrile is sourced from PubChem (CID 138551448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).