About 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile
3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile (PubChem CID 126668522) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile.
Molecular Properties
| Compound Name | 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile |
| PubChem CID | 126668522 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile |
| SMILES | N#CC1CC2NC(C1)C1OC21 |
| InChI | InChI=1S/C8H10N2O/c9-3-4-1-5-7-8(11-7)6(2-4)10-5/h4-8,10H,1-2H2 |
| InChIKey | UVIAVUYAXXXDAU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 48.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
The IUPAC name of 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile (CID 126668522) is 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile.
What is the SMILES notation for 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
The canonical SMILES for 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile is N#CC1CC2NC(C1)C1OC21.
What is the InChIKey of 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
The InChIKey is UVIAVUYAXXXDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c9-3-4-1-5-7-8(11-7)6(2-4)10-5/h4-8,10H,1-2H2.
What are the key properties of 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile?
3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile has a molecular weight of 150.18 g/mol, XLogP of 0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile is sourced from PubChem (CID 126668522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).