C8H10N2O — CID 126668522
3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile (PubChem CID 126668522) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile.
| Compound Name | 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile |
|---|---|
| PubChem CID | 126668522 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-oxa-9-azatricyclo[3.3.1.02,4]nonane-7-carbonitrile |
| SMILES | N#CC1CC2NC(C1)C1OC21 |
| InChI | InChI=1S/C8H10N2O/c9-3-4-1-5-7-8(11-7)6(2-4)10-5/h4-8,10H,1-2H2 |
| InChIKey | UVIAVUYAXXXDAU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 48.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|