C11H6N4O — CID 99733172
(1R,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane-6,6,7,7-tetracarbonitrile (PubChem CID 99733172) has the molecular formula C11H6N4O and a molecular weight of 210.20 g/mol. Its IUPAC name is (1R,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane-6,6,7,7-tetracarbonitrile.
| Compound Name | (1R,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane-6,6,7,7-tetracarbonitrile |
|---|---|
| PubChem CID | 99733172 |
| Molecular Formula | C11H6N4O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (1R,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]octane-6,6,7,7-tetracarbonitrile |
| SMILES | N#CC1(C#N)[C@H]2C[C@@H]([C@H]3O[C@H]32)C1(C#N)C#N |
| InChI | InChI=1S/C11H6N4O/c12-2-10(3-13)6-1-7(9-8(6)16-9)11(10,4-14)5-15/h6-9H,1H2/t6-,7-,8-,9+/m0/s1 |
| InChIKey | JOCAMWPLRNHQGQ-XSPKLOCKSA-N |
| XLogP | 0.47 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|