C8H7NO2 — CID 129322377
(1R,2R,3R,4R,5R,6S,7S)-6-hydroxy-8-oxatetracyclo[5.1.0.02,4.03,5]octane-3-carbonitrile (PubChem CID 129322377) has the molecular formula C8H7NO2 and a molecular weight of 149.15 g/mol. Its IUPAC name is (1R,2R,3R,4R,5R,6S,7S)-6-hydroxy-8-oxatetracyclo[5.1.0.02,4.03,5]octane-3-carbonitrile.
| Compound Name | (1R,2R,3R,4R,5R,6S,7S)-6-hydroxy-8-oxatetracyclo[5.1.0.02,4.03,5]octane-3-carbonitrile |
|---|---|
| PubChem CID | 129322377 |
| Molecular Formula | C8H7NO2 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | (1R,2R,3R,4R,5R,6S,7S)-6-hydroxy-8-oxatetracyclo[5.1.0.02,4.03,5]octane-3-carbonitrile |
| SMILES | N#C[C@]12[C@@H]3[C@H]1[C@H](O)[C@@H]1O[C@@H]1[C@H]32 |
| InChI | InChI=1S/C8H7NO2/c9-1-8-2-3(8)5(10)7-6(11-7)4(2)8/h2-7,10H/t2-,3+,4+,5+,6-,7+,8+/m1/s1 |
| InChIKey | MGINSDVEQQDQFH-GQEKDOMVSA-N |
| XLogP | -0.49 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|