C6H11NO4 — CID 24763422
(1R,2S,3R,4S,5R,6S)-5-amino-7-oxabicyclo[4.1.0]heptane-2,3,4-triol (PubChem CID 24763422) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is (1R,2S,3R,4S,5R,6S)-5-amino-7-oxabicyclo[4.1.0]heptane-2,3,4-triol.
| Compound Name | (1R,2S,3R,4S,5R,6S)-5-amino-7-oxabicyclo[4.1.0]heptane-2,3,4-triol |
|---|---|
| PubChem CID | 24763422 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (1R,2S,3R,4S,5R,6S)-5-amino-7-oxabicyclo[4.1.0]heptane-2,3,4-triol |
| SMILES | N[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C6H11NO4/c7-1-2(8)3(9)4(10)6-5(1)11-6/h1-6,8-10H,7H2/t1-,2+,3-,4+,5+,6-/m1/s1 |
| InChIKey | QSAHXUUZCZLEDF-MVKKHVDWSA-N |
| XLogP | -2.82 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|