C5H9NO4 — CID 163838966
(3R,4S,6R)-3-amino-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol (PubChem CID 163838966) has the molecular formula C5H9NO4 and a molecular weight of 147.13 g/mol. Its IUPAC name is (3R,4S,6R)-3-amino-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol.
| Compound Name | (3R,4S,6R)-3-amino-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
|---|---|
| PubChem CID | 163838966 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | (3R,4S,6R)-3-amino-2,7-dioxabicyclo[4.1.0]heptane-4,5-diol |
| SMILES | N[C@@H]1OC2O[C@@H]2C(O)[C@@H]1O |
| InChI | InChI=1S/C5H9NO4/c6-4-2(8)1(7)3-5(9-3)10-4/h1-5,7-8H,6H2/t1?,2-,3+,4+,5?/m0/s1 |
| InChIKey | OKFNVJBRDRCUQI-CCPJHEMMSA-N |
| XLogP | -2.25 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|