C6H13NO4 — CID 70182320
(2S,3R,4S,5S,6R)-2-amino-6-methyloxane-3,4,5-triol (PubChem CID 70182320) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-amino-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-amino-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 70182320 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-amino-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1O[C@H](N)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO4/c1-2-3(8)4(9)5(10)6(7)11-2/h2-6,8-10H,7H2,1H3/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey | UTVXFQMLZSPQLB-DVKNGEFBSA-N |
| XLogP | -2.23 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |