C7H15NO3 — CID 59078216
(2S,3R,4S,5R,6S)-5-amino-2,6-dimethyloxane-3,4-diol (PubChem CID 59078216) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-5-amino-2,6-dimethyloxane-3,4-diol.
| Compound Name | (2S,3R,4S,5R,6S)-5-amino-2,6-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 59078216 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (2S,3R,4S,5R,6S)-5-amino-2,6-dimethyloxane-3,4-diol |
| SMILES | C[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1N |
| InChI | InChI=1S/C7H15NO3/c1-3-5(8)7(10)6(9)4(2)11-3/h3-7,9-10H,8H2,1-2H3/t3-,4-,5-,6-,7-/m0/s1 |
| InChIKey | OJPYYJZUGWHVAN-RRNSMKEASA-N |
| XLogP | -1.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |