C6H12FNO3 — CID 130992916
(3S,4R,5S,6R)-5-amino-3-fluoro-6-methyloxane-2,4-diol (PubChem CID 130992916) has the molecular formula C6H12FNO3 and a molecular weight of 165.16 g/mol. Its IUPAC name is (3S,4R,5S,6R)-5-amino-3-fluoro-6-methyloxane-2,4-diol.
| Compound Name | (3S,4R,5S,6R)-5-amino-3-fluoro-6-methyloxane-2,4-diol |
|---|---|
| PubChem CID | 130992916 |
| Molecular Formula | C6H12FNO3 |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (3S,4R,5S,6R)-5-amino-3-fluoro-6-methyloxane-2,4-diol |
| SMILES | C[C@H]1OC(O)[C@@H](F)[C@H](O)[C@@H]1N |
| InChI | InChI=1S/C6H12FNO3/c1-2-4(8)5(9)3(7)6(10)11-2/h2-6,9-10H,8H2,1H3/t2-,3+,4-,5+,6?/m1/s1 |
| InChIKey | OTJJWUJQWBIGDD-YIDFTEPTSA-N |
| XLogP | -1.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |