C6H11BrFNO2 — CID 139771293
(2S,3R,4R,5S,6S)-5-amino-2-bromo-3-fluoro-6-methyloxan-4-ol (PubChem CID 139771293) has the molecular formula C6H11BrFNO2 and a molecular weight of 228.06 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-5-amino-2-bromo-3-fluoro-6-methyloxan-4-ol.
| Compound Name | (2S,3R,4R,5S,6S)-5-amino-2-bromo-3-fluoro-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 139771293 |
| Molecular Formula | C6H11BrFNO2 |
| Molecular Weight | 228.06 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | (2S,3R,4R,5S,6S)-5-amino-2-bromo-3-fluoro-6-methyloxan-4-ol |
| SMILES | C[C@@H]1O[C@@H](Br)[C@H](F)[C@H](O)[C@@H]1N |
| InChI | InChI=1S/C6H11BrFNO2/c1-2-4(9)5(10)3(8)6(7)11-2/h2-6,10H,9H2,1H3/t2-,3+,4+,5-,6+/m0/s1 |
| InChIKey | FWLAEIJARZTWJK-SXUWKVJYSA-N |
| XLogP | 0.15 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.06 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|