C5H10O4 — CID 59335588
(3R)-5-methyloxolane-2,3,4-triol (PubChem CID 59335588) has the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. Its IUPAC name is (3R)-5-methyloxolane-2,3,4-triol.
| Compound Name | (3R)-5-methyloxolane-2,3,4-triol |
|---|---|
| PubChem CID | 59335588 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | (3R)-5-methyloxolane-2,3,4-triol |
| SMILES | CC1OC(O)[C@H](O)C1O |
| InChI | InChI=1S/C5H10O4/c1-2-3(6)4(7)5(8)9-2/h2-8H,1H3/t2?,3?,4-,5?/m1/s1 |
| InChIKey | MKMRBXQLEMYZOY-VVPSWURXSA-N |
| XLogP | -1.55 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |