C6H14O6 — CID 135391148
(3R,4R,5R,6R)-6-methyloxane-2,3,4,5-tetrol;hydrate (PubChem CID 135391148) has the molecular formula C6H14O6 and a molecular weight of 182.17 g/mol. Its IUPAC name is (3R,4R,5R,6R)-6-methyloxane-2,3,4,5-tetrol;hydrate.
| Compound Name | (3R,4R,5R,6R)-6-methyloxane-2,3,4,5-tetrol;hydrate |
|---|---|
| PubChem CID | 135391148 |
| Molecular Formula | C6H14O6 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (3R,4R,5R,6R)-6-methyloxane-2,3,4,5-tetrol;hydrate |
| SMILES | C[C@H]1OC(O)[C@H](O)[C@H](O)[C@H]1O.O |
| InChI | InChI=1S/C6H12O5.H2O/c1-2-3(7)4(8)5(9)6(10)11-2;/h2-10H,1H3;1H2/t2-,3+,4-,5-,6?;/m1./s1 |
| InChIKey | BNRKZHXOBMEUGK-OHXGPSCHSA-N |
| XLogP | -3.02 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |