C5H11NO5 — CID 134274851
(2S,3R,4S,5R,6S)-6-aminooxane-2,3,4,5-tetrol (PubChem CID 134274851) has the molecular formula C5H11NO5 and a molecular weight of 165.15 g/mol. Its IUPAC name is (2S,3R,4S,5R,6S)-6-aminooxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R,6S)-6-aminooxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 134274851 |
| Molecular Formula | C5H11NO5 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2S,3R,4S,5R,6S)-6-aminooxane-2,3,4,5-tetrol |
| SMILES | N[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H11NO5/c6-4-2(8)1(7)3(9)5(10)11-4/h1-5,7-10H,6H2/t1-,2+,3+,4-,5-/m0/s1 |
| InChIKey | SGRNQBRQCKQFTH-FOJGRBBPSA-N |
| XLogP | -3.30 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |