C6H14N2O4 — CID 176999192
2,5-diamino-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 176999192) has the molecular formula C6H14N2O4 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2,5-diamino-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | 2,5-diamino-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 176999192 |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2,5-diamino-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | NC1OC(CO)C(N)C(O)C1O |
| InChI | InChI=1S/C6H14N2O4/c7-3-2(1-9)12-6(8)5(11)4(3)10/h2-6,9-11H,1,7-8H2 |
| InChIKey | WPZFIPKXFQEKOY-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |