C6H13NO5 — CID 174104618
(4S,5S)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 174104618) has the molecular formula C6H13NO5 and a molecular weight of 179.17 g/mol. Its IUPAC name is (4S,5S)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (4S,5S)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 174104618 |
| Molecular Formula | C6H13NO5 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | (4S,5S)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NC1OC(CO)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C6H13NO5/c7-6-5(11)4(10)3(9)2(1-8)12-6/h2-6,8-11H,1,7H2/t2?,3-,4+,5?,6?/m1/s1 |
| InChIKey | WCWOEQFAYSXBRK-DLABPRKASA-N |
| XLogP | -3.26 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |