C5H12N2O3 — CID 123760339
5-amino-3-(methylamino)oxolane-2,4-diol (PubChem CID 123760339) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is 5-amino-3-(methylamino)oxolane-2,4-diol.
| Compound Name | 5-amino-3-(methylamino)oxolane-2,4-diol |
|---|---|
| PubChem CID | 123760339 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 5-amino-3-(methylamino)oxolane-2,4-diol |
| SMILES | CNC1C(O)OC(N)C1O |
| InChI | InChI=1S/C5H12N2O3/c1-7-2-3(8)4(6)10-5(2)9/h2-5,7-9H,6H2,1H3 |
| InChIKey | FIEGTWQCTLEPLW-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |