C8H13NO6 — CID 176521588
2-hydroxy-2-[(2S,3S,4R,5R)-3,4,6-trihydroxy-5-(methylamino)oxan-2-yl]ethenone (PubChem CID 176521588) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is 2-hydroxy-2-[(2S,3S,4R,5R)-3,4,6-trihydroxy-5-(methylamino)oxan-2-yl]ethenone.
| Compound Name | 2-hydroxy-2-[(2S,3S,4R,5R)-3,4,6-trihydroxy-5-(methylamino)oxan-2-yl]ethenone |
|---|---|
| PubChem CID | 176521588 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-hydroxy-2-[(2S,3S,4R,5R)-3,4,6-trihydroxy-5-(methylamino)oxan-2-yl]ethenone |
| SMILES | CN[C@H]1C(O)O[C@H](C(O)=C=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H13NO6/c1-9-4-5(12)6(13)7(3(11)2-10)15-8(4)14/h4-9,11-14H,1H3/t4-,5-,6+,7-,8?/m1/s1 |
| InChIKey | YYEKNHUKGGBCMC-KEWYIRBNSA-N |
| XLogP | -2.71 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|