C8H17NO5 — CID 123282538
6-(methoxymethyl)-3-(methylamino)oxane-2,4,5-triol (PubChem CID 123282538) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is 6-(methoxymethyl)-3-(methylamino)oxane-2,4,5-triol.
| Compound Name | 6-(methoxymethyl)-3-(methylamino)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 123282538 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 6-(methoxymethyl)-3-(methylamino)oxane-2,4,5-triol |
| SMILES | CNC1C(O)OC(COC)C(O)C1O |
| InChI | InChI=1S/C8H17NO5/c1-9-5-7(11)6(10)4(3-13-2)14-8(5)12/h4-12H,3H2,1-2H3 |
| InChIKey | LYIVXDOPQVXWJZ-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |