C7H13ClO4 — CID 131010758
(2R,3S,4S,5S)-2-(chloromethyl)-5-(methoxymethyl)oxolane-3,4-diol (PubChem CID 131010758) has the molecular formula C7H13ClO4 and a molecular weight of 196.63 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(chloromethyl)-5-(methoxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-2-(chloromethyl)-5-(methoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 131010758 |
| Molecular Formula | C7H13ClO4 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | (2R,3S,4S,5S)-2-(chloromethyl)-5-(methoxymethyl)oxolane-3,4-diol |
| SMILES | COC[C@@H]1O[C@@H](CCl)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13ClO4/c1-11-3-5-7(10)6(9)4(2-8)12-5/h4-7,9-10H,2-3H2,1H3/t4-,5-,6+,7+/m0/s1 |
| InChIKey | IALNOOOMVORMQS-VWDOSNQTSA-N |
| XLogP | -0.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|