C6H11ClO5 — CID 12790194
(3S,4R,5S,6S)-6-(chloromethyl)oxane-2,3,4,5-tetrol (PubChem CID 12790194) has the molecular formula C6H11ClO5 and a molecular weight of 198.60 g/mol. Its IUPAC name is (3S,4R,5S,6S)-6-(chloromethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3S,4R,5S,6S)-6-(chloromethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 12790194 |
| Molecular Formula | C6H11ClO5 |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | (3S,4R,5S,6S)-6-(chloromethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC1O[C@H](CCl)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11ClO5/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-6,8-11H,1H2/t2-,3-,4-,5+,6?/m1/s1 |
| InChIKey | QMWDIHPSUCUMFU-RSVSWTKNSA-N |
| XLogP | -1.97 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|